CAS 14386-64-2

2-bromo-1-[3,5-di(tert-butyl)-4-hydroxyphenyl]ethan-1-one

Description:

2-bromo-1-[3,5-di(tert-butyl)-4-hydroxyphenyl]ethan-1-one is an organic compound characterized by its complex structure, which includes a bromine atom, a ketone functional group, and a phenolic moiety with bulky tert-butyl substituents. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The tert-butyl groups enhance the compound's lipophilicity and steric hindrance, which can influence its biological activity and solubility in organic solvents. The hydroxy group on the phenyl ring may impart antioxidant properties, making it of interest in pharmaceutical and materials science applications. Additionally, the compound's molecular structure suggests potential uses in the synthesis of more complex organic molecules or as a stabilizer in polymer formulations. Overall, its unique combination of functional groups and substituents makes it a versatile compound in organic chemistry.

Formula: C₁₆H₂₃BrO₂

InChI: InChI=1/C16H23BrO2/c1-15(2,3)11-7-10(13(18)9-17)8-12(14(11)19)16(4,5)6/h7-8,19H,9H2,1-6H3

SMILES: CC(C)(C)c1cc(cc(c1O)C(C)(C)C)C(=O)CBr

Synonyms:

• 2-Bromo-1-(3,5-Di-Tert-Butyl-4-Hydroxyphenyl)Ethanone
• 3,5-Di-tert-butyl-4-hydroxyphenacyl bromide

Ethanone, 1-[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]-2-bromo-

CAS: 14386-64-2

Formula: C₁₆H₂₃BrO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 327.2566

Ref: IN-DA001IIJ

3,5-Bis(tert-butyl)-4-hydroxyphenacyl bromide

CAS: 14386-64-2

3,5-Bis(tert-butyl)-4-hydroxyphenacyl bromide

Purity: 97%

Molecular weight: 327.26g/mol

Ref: 54-OR21940

2-Bromo-1-(3,5-di-tert-butyl-4-hydroxyphenyl)ethanone

CAS: 14386-64-2

Formula: C₁₆H₂₃BrO₂

Purity: 97%+(GC-MS);RG

Molecular weight: 327.262

Ref: 10-F064660