
CAS 143881-08-7
:2-[1-[3-(2-Phenylpyrazolo[1,5-a]pyridin-3-yl)-2(E)-propenoyl]piperidin-2(R)-yl]acetic acid
Description:
2-[1-[3-(2-Phenylpyrazolo[1,5-a]pyridin-3-yl)-2(E)-propenoyl]piperidin-2(R)-yl]acetic acid, with the CAS number 143881-08-7, is a complex organic compound characterized by its multi-functional structure, which includes a piperidine ring, a phenylpyrazolo moiety, and an acetic acid group. This compound exhibits potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the propenoyl group suggests reactivity that could be relevant in various chemical reactions, including potential interactions with biological targets. Its structural complexity may contribute to unique solubility and stability characteristics, influencing its behavior in biological systems. Additionally, the stereochemistry indicated by the (R) configuration at the piperidine position may play a crucial role in its interaction with biological receptors, affecting its efficacy and safety profile. Overall, this compound represents a class of molecules that may have applications in drug development, particularly in areas targeting specific pathways or diseases.
Formula:C23H23N3O3
InChI:InChI=1/C23H23N3O3/c27-21(25-14-6-4-10-18(25)16-22(28)29)13-12-19-20-11-5-7-15-26(20)24-23(19)17-8-2-1-3-9-17/h1-3,5,7-9,11-13,15,18H,4,6,10,14,16H2,(H,28,29)/b13-12+/t18-/m1/s1
Synonyms:- Fk-352B
- Fk-352
- {(2R)-1-[(2E)-3-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)prop-2-enoyl]piperidin-2-yl}acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(2R)-1-[(2E)-1-Oxo-3-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-2-propen-1-yl]-2-piperidineacetic acid
CAS:Controlled ProductFormula:C23H23N3O3Color and Shape:NeatMolecular weight:389.447FK-352
CAS:<p>FK-352 is a pyrazolopyridine derivative and adenosine-1 receptor antagonist.</p>Formula:C23H23N3O3Color and Shape:SolidMolecular weight:389.45

