CAS 1439-09-4

Pyrimidine, 5-bromo-4-methyl- (7CI,8CI,9CI)

Description:

Pyrimidine, 5-bromo-4-methyl- is a heterocyclic organic compound characterized by a six-membered ring containing two nitrogen atoms at positions 1 and 3, typical of pyrimidine derivatives. The presence of a bromine atom at the 5-position and a methyl group at the 4-position contributes to its unique chemical properties. This compound is typically colorless to pale yellow and may exhibit a range of solubility in organic solvents, depending on the specific solvent used. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The bromine substituent can enhance reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the methyl group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with biological targets. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed.

Formula: C₅H₅BrN₂

InChI: InChI=1/C5H5BrN2/c1-4-5(6)2-7-3-8-4/h2-3H,1H3

SMILES: Cc1c(cncn1)Br

Synonyms:

• 5-Bromo-4-Methylpyrimidine

5-Bromo-4-methylpyrimidine

CAS: 1439-09-4

Formula: C₅H₅BrN₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 173.0106

Ref: IN-DA007YF8

5-Bromo-4-methylpyrimidine

CAS: 1439-09-4

5-Bromo-4-methylpyrimidine

Purity: 97%

Molecular weight: 173.01g/mol

Ref: 54-OR903546

5-Bromo-4-methylpyrimidine

CAS: 1439-09-4

Formula: C₅H₅BrN₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 173.013

Ref: 10-F064468