CAS 14392-72-4: 4-Hydroxyheptanophenone

Description:4-Hydroxyheptanophenone, with the CAS number 14392-72-4, is an organic compound characterized by its ketone functional group and a hydroxyl group. This substance features a heptane chain, which contributes to its hydrophobic properties, while the phenone structure introduces aromatic characteristics. The presence of the hydroxyl group enhances its polarity, allowing for potential hydrogen bonding, which can influence its solubility in various solvents. Typically, compounds like 4-hydroxyheptanophenone may exhibit moderate to low volatility and can be used in various applications, including as intermediates in organic synthesis or in the formulation of certain materials. Its chemical stability and reactivity can be influenced by the functional groups present, making it a candidate for further chemical modifications. Additionally, the compound's physical properties, such as melting point and boiling point, would depend on its molecular structure and intermolecular interactions. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula:C₁₃H₁₈O₂

InChI:InChI=1S/C13H18O2/c1-2-3-4-5-6-13(15)11-7-9-12(14)10-8-11/h7-10,14H,2-6H2,1H3

InChI key:InChIKey=MAZPQHJYGKZQEA-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(O)C=C1)CCCCCC

Synonyms:
1-(4-Hydroxyphenyl)-1-heptanone
1-(4-Hydroxyphenyl)Heptan-1-One
1-Heptanone, 1-(4-hydroxyphenyl)-
4'-Hydroxy-N-Heptanophenone
4'-Hydroxy-N-Heptanophenone 98+%
4-Heptanoylphenol
4-Hydroxyphenyl Hexyl Ketone
Heptanophenone, 4′-hydroxy-
Hexyl 4-Hydroxyphenyl Ketone
p-Hydroxyheptanophenone
See more synonyms

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4'-Hydroxyheptanophenone REF: 3B-H0864CAS: 14392-72-4	>98.0%(GC)(T)	75.00 €~622.00 €	Mon 07 Apr 25
1-Heptanone, 1-(4-hydroxyphenyl)- REF: IN-DA001ILYCAS: 14392-72-4	98%	25.00 €~186.00 €	Mon 14 Apr 25
4'-Hydroxyheptanophenone REF: 10-F046152CAS: 14392-72-4	95%	- - -	Discontinued product
4-Hydroxy-n-heptanophenone REF: 3D-FH34272CAS: 14392-72-4	Min. 95%	- - -	Discontinued product