CAS 143934-15-0

AHN 683

Description:

AHN 683, with the CAS number 143934-15-0, is a chemical compound that functions primarily as a selective antagonist of the N-methyl-D-aspartate (NMDA) receptor. This compound is notable for its potential applications in neuroscience research, particularly in studies related to neuroprotection and the modulation of excitatory neurotransmission. AHN 683 exhibits a high affinity for the NMDA receptor, which plays a crucial role in synaptic plasticity and memory function. Its selective antagonism can help in understanding the mechanisms underlying various neurological disorders, including Alzheimer's disease and other forms of neurodegeneration. Additionally, AHN 683 may influence the activity of other neurotransmitter systems, making it a valuable tool for pharmacological studies. As with many research chemicals, safety and handling precautions are essential, as the full spectrum of its biological effects and potential toxicity may not be completely understood. Overall, AHN 683 represents a significant compound in the field of neuropharmacology, contributing to the exploration of therapeutic strategies for neurological conditions.

Formula: C₄₂H₃₂FN₃O₇

InChI: InChI=1/C42H32FN3O7/c1-4-22(2)46(3)40(50)35-18-23-7-5-6-8-28(23)38(45-35)30-19-25(10-16-34(30)43)44-39(49)24-9-13-31-29(17-24)41(51)53-42(31)32-14-11-26(47)20-36(32)52-37-21-27(48)12-15-33(37)42/h5-22,47-48H,4H2,1-3H3,(H,44,49)

SMILES: CCC(C)N(C)C(=O)c1cc2ccccc2c(c2cc(ccc2F)N=C(c2ccc3c(c2)C(=O)OC23c3ccc(cc3Oc3cc(ccc23)O)O)O)n1

Synonyms:

• 1-(2-Fluoro-5-N-(1,3-dihydro-1,1-bis(4-hydroxyphenyl)-3-oxo-5-isobenzofurancarboxamide)phenyl)-N-methyl-N-(1-methylpropyl)-3-isoquinoline carboxamide
• 3-Isoquinolinecarboxamide, 1-(5-(((3',6'-dihydroxy-3-oxospiro(isobenzofuran-1(3H),9'-(9H)xanthen)-5-yl)carbonyl)amino)-2-fluorophenyl)-N-methyl-N-(1-methylpropyl)-
• N-(butan-2-yl)-1-(5-{[(3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-5-yl)carbonyl]amino}-2-fluorophenyl)-N-methylisoquinoline-3-carboxamide

AHN-683

CAS: 143934-15-0

AHN-683 is a fluorescent ligand. It was used for peripheral-type benzodiazepine receptors.

Formula: C₄₂H₃₂FN₃O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 709.72

Ref: TM-T23675