CymitQuimica logo

CAS 1439818-48-0

:

2H-Pyran-2-one, 4-(3-azetidinyl)tetrahydro-, hydrochloride (1:1)

Description:
2H-Pyran-2-one, 4-(3-azetidinyl)tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyranone ring and an azetidine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and nitrogen-containing rings, which may influence its reactivity and biological activity. The hydrochloride form indicates that it is a salt, enhancing its solubility in polar solvents, which is often advantageous for pharmaceutical applications. The presence of the azetidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Its potential applications could span various fields, including drug development and agrochemicals, depending on its biological activity and stability. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of nitrogen and the potential for biological activity.
Formula:C8H13NO2·ClH
InChI:InChI=1S/C8H13NO2.ClH/c10-8-3-6(1-2-11-8)7-4-9-5-7;/h6-7,9H,1-5H2;1H
InChI key:InChIKey=XSMKKITWBKJWBC-UHFFFAOYSA-N
SMILES:O=C1CC(CCO1)C2CNC2.Cl
Synonyms:
  • 2H-Pyran-2-one, 4-(3-azetidinyl)tetrahydro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.