CymitQuimica logo

CAS 1439823-00-3

:

4-(4-Chloro-3H-imidazo[4,5-c]pyridin-2-yl)-2-methoxyphenol

Description:
4-(4-Chloro-3H-imidazo[4,5-c]pyridin-2-yl)-2-methoxyphenol is a chemical compound characterized by its complex structure, which includes an imidazo[4,5-c]pyridine moiety and a methoxyphenol group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the chloro substituent may influence its reactivity and interaction with biological targets. The methoxy group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, the imidazole ring contributes to the compound's ability to participate in hydrogen bonding and coordination with metal ions, which can be relevant in various chemical and biological contexts. Overall, this compound's unique structural features suggest potential applications in drug development, particularly in targeting specific biological pathways or receptors. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C13H10ClN3O2
InChI:InChI=1S/C13H10ClN3O2/c1-19-10-6-7(2-3-9(10)18)13-16-8-4-5-15-12(14)11(8)17-13/h2-6,18H,1H3,(H,16,17)
InChI key:InChIKey=CHKPFMALGLZKIV-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C2=NC=3C(N2)=CC=NC3Cl)C=CC1O
Synonyms:
  • 4-(4-Chloro-3H-imidazo[4,5-c]pyridin-2-yl)-2-methoxyphenol
  • Phenol, 4-(4-chloro-3H-imidazo[4,5-c]pyridin-2-yl)-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.