CymitQuimica logo

CAS 143984-56-9

:

6-[4-Methoxy-3-(1-methylcyclohexyl)phenyl]-2-naphthalenecarboxylic acid

Description:
6-[4-Methoxy-3-(1-methylcyclohexyl)phenyl]-2-naphthalenecarboxylic acid, with the CAS number 143984-56-9, is an organic compound characterized by its complex structure, which includes a naphthalene core substituted with a carboxylic acid group and a methoxy-phenyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the 1-methylcyclohexyl substituent contributes to its steric bulk, which can affect its conformational flexibility and overall molecular interactions. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Understanding the physicochemical properties, such as melting point, solubility, and spectral characteristics, is crucial for determining its behavior in various environments and applications.
Formula:C25H26O3
InChI:InChI=1S/C25H26O3/c1-25(12-4-3-5-13-25)22-16-20(10-11-23(22)28-2)18-6-7-19-15-21(24(26)27)9-8-17(19)14-18/h6-11,14-16H,3-5,12-13H2,1-2H3,(H,26,27)
InChI key:InChIKey=SWIWERVMTLKNLQ-UHFFFAOYSA-N
SMILES:CC1(C2=C(OC)C=CC(=C2)C3=CC4=C(C=C3)C=C(C(O)=O)C=C4)CCCCC1
Synonyms:
  • CD 2019
  • 6-[4-Methoxy-3-(1-methylcyclohexyl)phenyl]-2-naphthalenecarboxylic acid
  • 2-Naphthalenecarboxylic acid, 6-[4-methoxy-3-(1-methylcyclohexyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.