
CAS 1439894-51-5
:Urea, N-(4-pyridinylmethyl)-N′-(3R)-3-pyrrolidinyl-, hydrochloride (1:1)
Description:
Urea, N-(4-pyridinylmethyl)-N′-(3R)-3-pyrrolidinyl-, hydrochloride (1:1) is a chemical compound characterized by its urea backbone modified with pyridine and pyrrolidine functional groups. This compound typically appears as a white to off-white solid and is soluble in water, which is common for hydrochloride salts. The presence of the pyridine ring contributes to its potential biological activity, while the pyrrolidine moiety may influence its pharmacological properties. The hydrochloride form indicates that the compound is a salt, which can enhance its stability and solubility. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. As with many organic compounds, its properties such as melting point, boiling point, and specific reactivity would depend on the molecular structure and the presence of functional groups. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C11H16N4O.ClH
InChI:InChI=1S/C11H16N4O.ClH/c16-11(15-10-3-6-13-8-10)14-7-9-1-4-12-5-2-9;/h1-2,4-5,10,13H,3,6-8H2,(H2,14,15,16);1H/t10-;/m1./s1
InChI key:InChIKey=GHWMVDCRIUYDRG-HNCPQSOCSA-N
SMILES:N(C(NCC=1C=CN=CC1)=O)[C@@H]2CCNC2.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-1-(Pyridin-4-ylmethyl)-3-(pyrrolidin-3-yl)urea hydrochloride
CAS:Formula:C11H17ClN4OMolecular weight:256.73
