CAS 1439894-64-0

Urea, N-[(2-fluorophenyl)methyl]-N′-(3R)-3-pyrrolidinyl-, hydrochloride (1:1)

Description:

Urea, N-[(2-fluorophenyl)methyl]-N′-(3R)-3-pyrrolidinyl-, hydrochloride (1:1), identified by CAS number 1439894-64-0, is a chemical compound that features a urea functional group modified with a 2-fluorophenylmethyl moiety and a pyrrolidine ring. This compound is characterized by its potential pharmacological properties, which may include interactions with specific biological targets, making it of interest in medicinal chemistry. The presence of the fluorophenyl group can enhance lipophilicity and influence the compound's binding affinity to receptors or enzymes. The hydrochloride salt form indicates that it is likely to be more soluble in water, which is advantageous for biological assays and potential therapeutic applications. Additionally, the stereochemistry of the pyrrolidine ring (3R configuration) may play a crucial role in the compound's biological activity and selectivity. Overall, this compound represents a class of molecules that may have implications in drug development, particularly in areas targeting neurological or psychiatric conditions.

Formula: C₁₂H₁₆FN₃O·ClH

InChI: InChI=1S/C12H16FN3O.ClH/c13-11-4-2-1-3-9(11)7-15-12(17)16-10-5-6-14-8-10;/h1-4,10,14H,5-8H2,(H2,15,16,17);1H/t10-;/m1./s1

InChI key: InChIKey=VESNDHBZJGPMDE-HNCPQSOCSA-N

SMILES: C(NC(N[C@@H]1CCNC1)=O)C2=C(F)C=CC=C2.Cl

Synonyms:

• Urea, N-[(2-fluorophenyl)methyl]-N′-(3R)-3-pyrrolidinyl-, hydrochloride (1:1)

(R)-1-(2-Fluorobenzyl)-3-(pyrrolidin-3-yl)urea hydrochloride

CAS: 1439894-64-0

Formula: C₁₂H₁₇ClFN₃O

Molecular weight: 273.74

Ref: 10-F096870