CAS 1439894-65-1

Urea, N-[(4-fluorophenyl)methyl]-N′-(3R)-3-pyrrolidinyl-, hydrochloride (1:1)

Description:

Urea, N-[(4-fluorophenyl)methyl]-N′-(3R)-3-pyrrolidinyl-, hydrochloride (1:1), identified by CAS number 1439894-65-1, is a chemical compound characterized by its urea functional group, which is central to its structure. This compound features a 4-fluorophenyl group, contributing to its potential biological activity, and a pyrrolidine ring that may influence its pharmacological properties. The hydrochloride salt form indicates that it is a hydrochloride, which typically enhances solubility in water and may improve stability. The presence of the fluorine atom suggests potential applications in medicinal chemistry, as fluorinated compounds often exhibit altered metabolic pathways and enhanced biological activity. This compound may be of interest in research related to pharmaceuticals, particularly in the development of drugs targeting specific receptors or pathways. Its specific stereochemistry, indicated by the (3R) designation, suggests that it may exhibit chiral properties, which can significantly affect its interaction with biological systems. Overall, this compound's unique structural features position it as a candidate for further investigation in various chemical and biological applications.

Formula: C₁₂H₁₆FN₃O·ClH

InChI: InChI=1S/C12H16FN3O.ClH/c13-10-3-1-9(2-4-10)7-15-12(17)16-11-5-6-14-8-11;/h1-4,11,14H,5-8H2,(H2,15,16,17);1H/t11-;/m1./s1

InChI key: InChIKey=VSVVPMJZUOHRGL-RFVHGSKJSA-N

SMILES: N(C(NCC1=CC=C(F)C=C1)=O)[C@@H]2CCNC2.Cl

Synonyms:

• Urea, N-[(4-fluorophenyl)methyl]-N′-(3R)-3-pyrrolidinyl-, hydrochloride (1:1)

(R)-1-(4-Fluorobenzyl)-3-(pyrrolidin-3-yl)urea hydrochloride

CAS: 1439894-65-1

Formula: C₁₂H₁₇ClFN₃O

Molecular weight: 273.74

Ref: 10-F096868