CAS 1439896-38-4

Cyclobutanamine, 1-[(3-fluorophenyl)methyl]-, hydrochloride (1:1)

Description:

Cyclobutanamine, 1-[(3-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its cyclobutane ring structure, which contributes to its unique properties. The presence of a 3-fluorophenyl group indicates that the compound has a fluorine atom substituted on the aromatic ring, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit specific pharmacological properties due to its amine functional group, which can participate in hydrogen bonding and interact with biological targets. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields, including drug development and chemical synthesis.

Formula: C₁₁H₁₄FN·ClH

InChI: InChI=1S/C11H14FN.ClH/c12-10-4-1-3-9(7-10)8-11(13)5-2-6-11;/h1,3-4,7H,2,5-6,8,13H2;1H

InChI key: InChIKey=OQJVCQKQTMEBGQ-UHFFFAOYSA-N

SMILES: C(C1(N)CCC1)C2=CC(F)=CC=C2.Cl

Synonyms:

• Cyclobutanamine, 1-[(3-fluorophenyl)methyl]-, hydrochloride (1:1)

1-[(3-Fluorophenyl)methyl]cyclobutan-1-amine hydrochloride

CAS: 1439896-38-4

Formula: C₁₁H₁₅ClFN

Molecular weight: 215.7

Ref: 10-F096991

1-[(3-Fluorophenyl)methyl]cyclobutan-1-amine hydrochloride

CAS: 1439896-38-4

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClFN

Purity: Min. 95%

Molecular weight: 215.69 g/mol

Ref: 3D-PHC89638