CymitQuimica logo

CAS 1439896-42-0

:

1-(3-Bromophenyl)-1H-imidazole-5-carboxylic acid

Description:
1-(3-Bromophenyl)-1H-imidazole-5-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the meta position relative to the imidazole. This compound features a carboxylic acid functional group, which contributes to its acidity and potential for forming hydrogen bonds. The molecular structure suggests that it may exhibit interesting biological activity, potentially serving as a scaffold for drug development or as a research tool in medicinal chemistry. Its solubility and reactivity can be influenced by the bromine substituent and the carboxylic acid group, making it a candidate for various chemical reactions, including esterification and amidation. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for its identification and application in laboratory settings.
Formula:C10H7BrN2O2
InChI:InChI=1S/C10H7BrN2O2/c11-7-2-1-3-8(4-7)13-6-12-5-9(13)10(14)15/h1-6H,(H,14,15)
InChI key:InChIKey=NDZYUMCZWUWBJW-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N(C=NC1)C2=CC(Br)=CC=C2
Synonyms:
  • 1-(3-Bromophenyl)-1H-imidazole-5-carboxylic acid
  • 1H-Imidazole-5-carboxylic acid, 1-(3-bromophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.