CymitQuimica logo

CAS 1439896-48-6

:

2-[[(Tetrahydro-2H-pyran-4-yl)methyl]amino]-5-pyrimidinecarboxylic acid

Description:
2-[[(Tetrahydro-2H-pyran-4-yl)methyl]amino]-5-pyrimidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a tetrahydropyran moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of both amino and carboxylic functional groups. The tetrahydropyran ring contributes to its cyclic structure, which can influence its reactivity and interaction with biological systems. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on its purity and the conditions under which it is studied. Overall, this compound represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C11H15N3O3
InChI:InChI=1S/C11H15N3O3/c15-10(16)9-6-13-11(14-7-9)12-5-8-1-3-17-4-2-8/h6-8H,1-5H2,(H,15,16)(H,12,13,14)
InChI key:InChIKey=XFRWMZXFRKENIT-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)C=2N=CC(C(O)=O)=CN2
Synonyms:
  • 2-[[(Tetrahydro-2H-pyran-4-yl)methyl]amino]-5-pyrimidinecarboxylic acid
  • 5-Pyrimidinecarboxylic acid, 2-[[(tetrahydro-2H-pyran-4-yl)methyl]amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.