CAS 1439896-49-7

1H-Imidazole-4-carboxylic acid, 1-(2-methylpropyl)-, hydrochloride (1:1)

Description:

1H-Imidazole-4-carboxylic acid, 1-(2-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a 2-methylpropyl substituent that enhances its hydrophobic characteristics. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically improves its solubility in water and stability. This substance may exhibit biological activity due to the presence of the imidazole moiety, which is commonly found in various biological molecules, including amino acids and nucleotides. Its potential applications could span pharmaceuticals, agrochemicals, or as a biochemical probe, depending on its specific interactions and properties. As with many imidazole derivatives, it may also participate in coordination chemistry, forming complexes with metal ions. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₈H₁₂N₂O₂·ClH

InChI: InChI=1S/C8H12N2O2.ClH/c1-6(2)3-10-4-7(8(11)12)9-5-10;/h4-6H,3H2,1-2H3,(H,11,12);1H

InChI key: InChIKey=MVUXGERSHBCZCV-UHFFFAOYSA-N

SMILES: C(C(C)C)N1C=C(C(O)=O)N=C1.Cl

Synonyms:

• 1H-Imidazole-4-carboxylic acid, 1-(2-methylpropyl)-, hydrochloride (1:1)

1-Isobutyl-1H-imidazole-4-carboxylic acid hydrochloride

CAS: 1439896-49-7

Formula: C₈H₁₃ClN₂O₂

Molecular weight: 204.65

Ref: 10-F096849