CAS 1439896-51-1
:4-(Cyclobutylmethoxy)-3-pyridinecarboxylic acid
Description:
4-(Cyclobutylmethoxy)-3-pyridinecarboxylic acid, identified by its CAS number 1439896-51-1, is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a cyclobutyl group and a methoxy substituent contributes to its unique structural properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic cyclobutyl moiety. The carboxylic acid functional group is likely to impart acidic properties, allowing for potential interactions in various chemical environments. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific reactivity and interactions would depend on the functional groups present and their spatial arrangement, which can influence its behavior in chemical reactions and biological systems. Overall, this compound represents a unique structure that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c13-11(14)9-6-12-5-4-10(9)15-7-8-2-1-3-8/h4-6,8H,1-3,7H2,(H,13,14)
InChI key:InChIKey=WOQZIHPBIIXLLJ-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C=2C(C(O)=O)=CN=CC2
Synonyms:- 4-(Cyclobutylmethoxy)-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 4-(cyclobutylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
