CymitQuimica logo

CAS 1439896-56-6

:

[1(2H),4′-Bipyrimidine]-6′-carboxylic acid, 3,4,5,6-tetrahydro-2-oxo-

Description:
[1(2H),4′-Bipyrimidine]-6′-carboxylic acid, 3,4,5,6-tetrahydro-2-oxo- is a chemical compound characterized by its bipyrimidine structure, which consists of two pyrimidine rings connected by a carbon atom. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the tetrahydro-2-oxo moiety indicates that it has a saturated cyclic structure with a carbonyl group, which can influence its reactivity and interactions with other molecules. The compound may exhibit properties such as solubility in polar solvents, and its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the specific arrangement of substituents can affect its biological activity, making it a subject of interest for further research. As with many organic compounds, its stability, reactivity, and interactions can be influenced by environmental factors such as pH and temperature.
Formula:C9H10N4O3
InChI:InChI=1S/C9H10N4O3/c14-8(15)6-4-7(12-5-11-6)13-3-1-2-10-9(13)16/h4-5H,1-3H2,(H,10,16)(H,14,15)
InChI key:InChIKey=RRTNRCGPAFEKQH-UHFFFAOYSA-N
SMILES:O=C1N(C=2C=C(C(O)=O)N=CN2)CCCN1
Synonyms:
  • 6-[2-Oxo-tetrahydropyrimidin-1(2H)-yl]pyrimidine-4-carboxylic acid
  • [1(2H),4′-Bipyrimidine]-6′-carboxylic acid, 3,4,5,6-tetrahydro-2-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.