CymitQuimica logo

CAS 1439896-57-7

:

2-(Cyclobutylmethoxy)-5-pyrimidinamine

Description:
2-(Cyclobutylmethoxy)-5-pyrimidinamine is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with an amine group and a cyclobutylmethoxy group. The presence of the pyrimidine moiety suggests potential biological activity, as pyrimidines are often found in various pharmaceuticals and biologically active compounds. The cyclobutyl group contributes to the compound's three-dimensional structure, potentially influencing its interaction with biological targets. This compound may exhibit properties such as solubility in organic solvents, depending on its functional groups, and could participate in hydrogen bonding due to the amine functionality. Its molecular weight, stability, and reactivity would be influenced by the specific arrangement of atoms and the presence of functional groups. As with many organic compounds, the characteristics of 2-(Cyclobutylmethoxy)-5-pyrimidinamine can be further explored through techniques such as NMR spectroscopy, mass spectrometry, and crystallography to understand its behavior in various chemical environments.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c10-8-4-11-9(12-5-8)13-6-7-2-1-3-7/h4-5,7H,1-3,6,10H2
InChI key:InChIKey=ZRFUAMQCHQZFDP-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C=2N=CC(N)=CN2
Synonyms:
  • 2-(Cyclobutylmethoxy)-5-pyrimidinamine
  • 5-Pyrimidinamine, 2-(cyclobutylmethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.