CymitQuimica logo

CAS 1439896-85-1

:

6-(2-Methoxyethoxy)-4-pyrimidinecarboxylic acid

Description:
6-(2-Methoxyethoxy)-4-pyrimidinecarboxylic acid is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of the carboxylic acid functional group (-COOH) indicates that it can act as an acid, participating in proton transfer reactions. The methoxyethoxy substituent contributes to its solubility in organic solvents and may influence its reactivity and interaction with biological systems. This compound may exhibit properties such as moderate polarity due to the combination of hydrophilic (carboxylic acid) and hydrophobic (methoxyethoxy) groups. Its structure suggests potential applications in pharmaceuticals or agrochemicals, where pyrimidine derivatives are often explored for their biological activity. Additionally, the compound's molecular interactions could be studied for its potential role in drug design or as a building block in organic synthesis. Overall, the unique combination of functional groups and the pyrimidine core make it a compound of interest in various chemical research fields.
Formula:C8H10N2O4
InChI:InChI=1S/C8H10N2O4/c1-13-2-3-14-7-4-6(8(11)12)9-5-10-7/h4-5H,2-3H2,1H3,(H,11,12)
InChI key:InChIKey=GXXHHMLVOAWDOM-UHFFFAOYSA-N
SMILES:O(CCOC)C=1C=C(C(O)=O)N=CN1
Synonyms:
  • 4-Pyrimidinecarboxylic acid, 6-(2-methoxyethoxy)-
  • 6-(2-Methoxyethoxy)-4-pyrimidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.