CAS 1439897-61-6
:1-[(3-Fluorophenyl)methyl]-1H-imidazole-2-carboxylic acid
Description:
1-[(3-Fluorophenyl)methyl]-1H-imidazole-2-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, contributing to its potential reactivity and solubility in polar solvents. The 3-fluorophenyl group attached to the imidazole ring enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound may exhibit various properties such as antimicrobial, antifungal, or anti-inflammatory activities, depending on its specific interactions with biological targets. Its molecular structure suggests potential applications in drug development, particularly in the design of pharmaceuticals targeting specific pathways or diseases. As with many chemical substances, safety data and handling precautions should be considered, especially regarding its potential toxicity and environmental impact.
Formula:C11H9FN2O2
InChI:InChI=1S/C11H9FN2O2/c12-9-3-1-2-8(6-9)7-14-5-4-13-10(14)11(15)16/h1-6H,7H2,(H,15,16)
InChI key:InChIKey=AWCLWIBIPNQHCV-UHFFFAOYSA-N
SMILES:C(N1C(C(O)=O)=NC=C1)C2=CC(F)=CC=C2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
