CAS 1439897-73-0

1-[(3-Bromophenyl)methyl]-1H-imidazole-5-carboxylic acid

Description:

1-[(3-Bromophenyl)methyl]-1H-imidazole-5-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a carboxylic acid functional group (-COOH) at the 5-position of the imidazole ring contributes to its acidic properties and potential reactivity. The compound also features a 3-bromophenyl group attached to the imidazole via a methyl linkage, which can influence its biological activity and solubility. This substitution pattern may enhance its lipophilicity and alter its interaction with biological targets. The bromine atom can also introduce unique electronic properties, potentially affecting the compound's reactivity and stability. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and spectral data, would require empirical measurement or literature reference for detailed analysis.

Formula: C₁₁H₉BrN₂O₂

InChI: InChI=1S/C11H9BrN2O2/c12-9-3-1-2-8(4-9)6-14-7-13-5-10(14)11(15)16/h1-5,7H,6H2,(H,15,16)

InChI key: InChIKey=YQHGYBXDJCOTRL-UHFFFAOYSA-N

SMILES: C(N1C(C(O)=O)=CN=C1)C2=CC(Br)=CC=C2

Synonyms:

• 1H-Imidazole-5-carboxylic acid, 1-[(3-bromophenyl)methyl]-
• 1-[(3-Bromophenyl)methyl]-1H-imidazole-5-carboxylic acid

1-(3-Bromobenzyl)-1H-imidazole-5-carboxylic acid

CAS: 1439897-73-0

Formula: C₁₁H₉BrN₂O₂

Molecular weight: 281.109

Ref: 10-F096746