
CAS 1439897-84-3
:Cyclopropanamine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:1)
Description:
Cyclopropanamine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and an amine functional group. The presence of a 2-fluorophenyl group indicates that there is a fluorine atom substituted on the phenyl ring, which can influence the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as potential neuroactivity or other biological effects, making it of interest in medicinal chemistry. Its molecular structure suggests that it could interact with various biological targets, possibly influencing neurotransmitter systems. However, specific pharmacological data and safety profiles would need to be evaluated through experimental studies to fully understand its characteristics and potential applications.
Formula:C10H12FN·ClH
InChI:InChI=1S/C10H12FN.ClH/c11-9-4-2-1-3-8(9)7-10(12)5-6-10;/h1-4H,5-7,12H2;1H
InChI key:InChIKey=GUCPLWXLBSUSCT-UHFFFAOYSA-N
SMILES:C(C1(N)CC1)C2=C(F)C=CC=C2.Cl
Synonyms:- Cyclopropanamine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[(2-Fluorophenyl)methyl]cyclopropan-1-amine hydrochloride
CAS:Formula:C10H13ClFNMolecular weight:201.67
