CAS 1439898-27-7

1-[(2-Fluorophenyl)methyl]-1H-imidazole-2-carboxylic acid

Description:

1-[(2-Fluorophenyl)methyl]-1H-imidazole-2-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, contributing to its potential reactivity and solubility in polar solvents. The 2-fluorophenyl group attached to the imidazole ring introduces a fluorine atom, which can influence the compound's electronic properties and biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential interactions with biological targets, and it may be explored for applications in drug development. Additionally, the presence of both aromatic and heterocyclic components can enhance its stability and reactivity. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical and pharmaceutical applications.

Formula: C₁₁H₉FN₂O₂

InChI: InChI=1S/C11H9FN2O2/c12-9-4-2-1-3-8(9)7-14-6-5-13-10(14)11(15)16/h1-6H,7H2,(H,15,16)

InChI key: InChIKey=SJQMCIQETZDTMW-UHFFFAOYSA-N

SMILES: C(N1C(C(O)=O)=NC=C1)C2=C(F)C=CC=C2

Synonyms:

• 1H-Imidazole-2-carboxylic acid, 1-[(2-fluorophenyl)methyl]-
• 1-[(2-Fluorophenyl)methyl]-1H-imidazole-2-carboxylic acid
• 1-(2-Fluorobenzyl)-1H-imidazole-2-carboxylic acid

1-(2-Fluorobenzyl)-1H-imidazole-2-carboxylic acid

CAS: 1439898-27-7

Formula: C₁₁H₉FN₂O₂

Molecular weight: 220.203

Ref: 10-F096889