CAS 1439898-28-8

1-[(3-Bromophenyl)methyl]-1H-imidazole-2-carboxylic acid

Description:

1-[(3-Bromophenyl)methyl]-1H-imidazole-2-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromophenyl group indicates that a bromine atom is substituted on the phenyl ring, contributing to the compound's unique reactivity and potential biological activity. The carboxylic acid functional group (-COOH) enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its interactions in biological systems. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with altered biological properties. Additionally, the presence of the bromine atom can enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, 1-[(3-Bromophenyl)methyl]-1H-imidazole-2-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and drug development.

Formula: C₁₁H₉BrN₂O₂

InChI: InChI=1S/C11H9BrN2O2/c12-9-3-1-2-8(6-9)7-14-5-4-13-10(14)11(15)16/h1-6H,7H2,(H,15,16)

InChI key: InChIKey=AJMOXESJEBOORU-UHFFFAOYSA-N

SMILES: C(N1C(C(O)=O)=NC=C1)C2=CC(Br)=CC=C2

Synonyms:

• 1H-Imidazole-2-carboxylic acid, 1-[(3-bromophenyl)methyl]-
• 1-[(3-Bromophenyl)methyl]-1H-imidazole-2-carboxylic acid

1-(3-Bromobenzyl)-1H-imidazole-2-carboxylic acid

CAS: 1439898-28-8

Formula: C₁₁H₉BrN₂O₂

Molecular weight: 281.109

Ref: 10-F096740