CAS 1439899-02-1

6-[(Tetrahydro-2H-pyran-4-yl)amino]-4-pyrimidinecarboxylic acid

Description:

6-[(Tetrahydro-2H-pyran-4-yl)amino]-4-pyrimidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a tetrahydro-2H-pyran moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities, making it potentially useful in medicinal chemistry and pharmaceutical applications. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the tetrahydro-2H-pyran ring contributes to the compound's overall stability and may affect its biological activity. The molecular structure allows for various interactions with biological targets, which could be relevant in drug design. As with many pyrimidine derivatives, this compound may exhibit a range of biological activities, including antimicrobial or antitumor properties, although specific activities would depend on further empirical studies. Overall, its unique combination of functional groups positions it as a compound of interest in chemical research and development.

Formula: C₁₀H₁₃N₃O₃

InChI: InChI=1S/C10H13N3O3/c14-10(15)8-5-9(12-6-11-8)13-7-1-3-16-4-2-7/h5-7H,1-4H2,(H,14,15)(H,11,12,13)

InChI key: InChIKey=FAALTEVKCMLQDZ-UHFFFAOYSA-N

SMILES: N(C=1C=C(C(O)=O)N=CN1)C2CCOCC2

Synonyms:

• 4-Pyrimidinecarboxylic acid, 6-[(tetrahydro-2H-pyran-4-yl)amino]-
• 6-[(Tetrahydro-2H-pyran-4-yl)amino]-4-pyrimidinecarboxylic acid

6-(Tetrahydro-2H-pyran-4-ylamino)pyrimidine-4-carboxylic acid

CAS: 1439899-02-1

Formula: C₁₀H₁₃N₃O₃

Molecular weight: 223.232

Ref: 10-F096779