CymitQuimica logo

CAS 1439899-06-5

:

1-[(4-Chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid

Description:
1-[(4-Chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a 4-chlorobenzyl group enhances its lipophilicity and may influence its biological activity. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The compound's solubility, stability, and reactivity can be affected by the substituents on the imidazole and phenyl rings. As with many heterocyclic compounds, it may also participate in various chemical reactions, including nucleophilic substitutions or coupling reactions. Overall, 1-[(4-Chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid represents a versatile scaffold for further chemical modifications and potential therapeutic applications.
Formula:C11H9ClN2O2
InChI:InChI=1S/C11H9ClN2O2/c12-9-3-1-8(2-4-9)6-14-7-13-5-10(14)11(15)16/h1-5,7H,6H2,(H,15,16)
InChI key:InChIKey=BZLCPYFPLKYRIZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N(CC2=CC=C(Cl)C=C2)C=NC1
Synonyms:
  • 1-[(4-Chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid
  • 1H-Imidazole-5-carboxylic acid, 1-[(4-chlorophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.