CAS 1439899-09-8

1-[(4-Bromophenyl)methyl]-1H-imidazole-2-carboxylic acid

Description:

1-[(4-Bromophenyl)methyl]-1H-imidazole-2-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromophenyl group enhances its potential for biological activity, as halogenated phenyl groups often exhibit unique interactions in medicinal chemistry. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, making it suitable for various applications in organic synthesis and pharmaceutical development. This compound may exhibit properties such as antimicrobial or antifungal activity, typical of many imidazole derivatives. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug design. Additionally, the bromine substituent can influence the compound's electronic properties and reactivity, making it a valuable candidate for further research in medicinal chemistry and related fields. Overall, this compound's unique structural features suggest it may have significant implications in various chemical and biological contexts.

Formula: C₁₁H₉BrN₂O₂

InChI: InChI=1S/C11H9BrN2O2/c12-9-3-1-8(2-4-9)7-14-6-5-13-10(14)11(15)16/h1-6H,7H2,(H,15,16)

InChI key: InChIKey=LEIDCTDFCOLOJC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N(CC2=CC=C(Br)C=C2)C=CN1

Synonyms:

• 1H-Imidazole-2-carboxylic acid, 1-[(4-bromophenyl)methyl]-
• 1-[(4-Bromophenyl)methyl]-1H-imidazole-2-carboxylic acid

1-(4-Bromobenzyl)-1H-imidazole-2-carboxylic acid

CAS: 1439899-09-8

Formula: C₁₁H₉BrN₂O₂

Molecular weight: 281.109

Ref: 10-F096739