CAS 1439899-31-6
:6-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyrimidinecarboxylic acid
Description:
6-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyrimidinecarboxylic acid is a chemical compound characterized by its pyrimidine and tetrahydropyran moieties. The presence of the pyrimidine ring contributes to its potential biological activity, as pyrimidines are often found in nucleic acids and various pharmaceuticals. The tetrahydropyran group introduces a cyclic ether structure, which can influence the compound's solubility and reactivity. This compound is likely to exhibit polar characteristics due to the carboxylic acid functional group, which can participate in hydrogen bonding and affect its interaction with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with antiviral or antibacterial properties. Additionally, the specific stereochemistry of the tetrahydropyran ring may play a crucial role in determining the compound's pharmacokinetic and pharmacodynamic profiles. Overall, this compound represents a unique combination of functional groups that may contribute to its therapeutic potential.
Formula:C10H12N2O4
InChI:InChI=1S/C10H12N2O4/c13-10(14)8-5-9(12-6-11-8)16-7-1-3-15-4-2-7/h5-7H,1-4H2,(H,13,14)
InChI key:InChIKey=ZZWLMUZIGKDTBM-UHFFFAOYSA-N
SMILES:O(C=1C=C(C(O)=O)N=CN1)C2CCOCC2
Synonyms:- 6-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyrimidinecarboxylic acid
- 4-Pyrimidinecarboxylic acid, 6-[(tetrahydro-2H-pyran-4-yl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(Tetrahydro-2H-pyran-4-yloxy)pyrimidine-4-carboxylic acid
CAS:Formula:C10H12N2O4Molecular weight:224.216
