CAS 1439899-34-9

2H-Pyran-4-amine, 4-(4-chlorophenyl)tetrahydro-, hydrochloride (1:1)

Description:

2H-Pyran-4-amine, 4-(4-chlorophenyl)tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyran ring fused with an amine group and a chlorophenyl substituent. This compound typically appears as a hydrochloride salt, indicating that it is soluble in water and may exhibit different properties compared to its free base form. The presence of the 4-chlorophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the influence of halogen substituents on biological activity. The compound's molecular structure may contribute to its reactivity and interaction with biological targets. Additionally, the hydrochloride form often enhances stability and solubility, making it easier to handle in laboratory settings. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure. Overall, this compound represents a class of organic molecules that may have significant implications in research and development within the field of chemistry and pharmacology.

Formula: C₁₁H₁₄ClNO·ClH

InChI: InChI=1S/C11H14ClNO.ClH/c12-10-3-1-9(2-4-10)11(13)5-7-14-8-6-11;/h1-4H,5-8,13H2;1H

InChI key: InChIKey=PNKITSBQBRKWLL-UHFFFAOYSA-N

SMILES: NC1(CCOCC1)C2=CC=C(Cl)C=C2.Cl

Synonyms:

• 2H-Pyran-4-amine, 4-(4-chlorophenyl)tetrahydro-, hydrochloride (1:1)

4-(4-Chlorophenyl)oxan-4-amine hydrochloride

CAS: 1439899-34-9

Versatile small molecule scaffold

Formula: C₁₁H₁₅Cl₂NO

Purity: Min. 95%

Molecular weight: 248.15 g/mol

Ref: 3D-PHC89934