CAS 1439899-35-0

1-[(2-Chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid

Description:

1-[(2-Chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a carboxylic acid functional group contributes to its acidic properties, while the 2-chlorophenylmethyl substituent enhances its potential for biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The chlorine atom on the phenyl ring can affect the compound's lipophilicity and overall reactivity. Additionally, the imidazole moiety is known for its role in biological systems, particularly in the context of enzyme catalysis and as a building block in various pharmaceuticals. Overall, this compound's unique structural features may contribute to its utility in research and development within the fields of medicinal and organic chemistry.

Formula: C₁₁H₉ClN₂O₂

InChI: InChI=1S/C11H9ClN2O2/c12-9-4-2-1-3-8(9)6-14-7-13-5-10(14)11(15)16/h1-5,7H,6H2,(H,15,16)

InChI key: InChIKey=HOTGTDNBIDFEIV-UHFFFAOYSA-N

SMILES: C(N1C(C(O)=O)=CN=C1)C2=C(Cl)C=CC=C2

Synonyms:

• 1H-Imidazole-5-carboxylic acid, 1-[(2-chlorophenyl)methyl]-
• 1-[(2-Chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid

1-(2-Chlorobenzyl)-1H-imidazole-5-carboxylic acid

CAS: 1439899-35-0

Formula: C₁₁H₉ClN₂O₂

Color and Shape: Solid

Molecular weight: 236.66

Ref: 10-F096750