CymitQuimica logo

CAS 1439899-36-1

:

1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-5-carboxylic acid

Description:
1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-5-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) on the phenyl ring significantly influences its electronic properties, enhancing lipophilicity and potentially affecting its biological activity. The carboxylic acid functional group (-COOH) contributes to its acidity and can participate in hydrogen bonding, making it relevant in various chemical reactions and interactions. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the trifluoromethyl group is known to improve metabolic stability and bioavailability, which are crucial factors in pharmaceutical design. Overall, this compound's unique characteristics stem from its functional groups and molecular structure, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C12H9F3N2O2
InChI:InChI=1S/C12H9F3N2O2/c13-12(14,15)9-4-2-1-3-8(9)6-17-7-16-5-10(17)11(18)19/h1-5,7H,6H2,(H,18,19)
InChI key:InChIKey=XEAYAXLVZNSDBO-UHFFFAOYSA-N
SMILES:C(C1=C(C(F)(F)F)C=CC=C1)N2C(C(O)=O)=CN=C2
Synonyms:
  • 1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-5-carboxylic acid
  • 1H-Imidazole-5-carboxylic acid, 1-[[2-(trifluoromethyl)phenyl]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.