CAS 1439899-43-0

1-[[3-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-5-carboxylic acid

Description:

1-[[3-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-5-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a trifluoromethyl group, which is known for its strong electron-withdrawing properties, enhancing the compound's lipophilicity and potentially influencing its biological activity. The presence of the carboxylic acid functional group contributes to its acidity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the trifluoromethyl group can enhance metabolic stability and bioavailability. Overall, the unique combination of functional groups in this compound may lead to diverse chemical reactivity and interactions, making it a valuable candidate for further research in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₂H₉F₃N₂O₂

InChI: InChI=1S/C12H9F3N2O2/c13-12(14,15)9-3-1-2-8(4-9)6-17-7-16-5-10(17)11(18)19/h1-5,7H,6H2,(H,18,19)

InChI key: InChIKey=WJGQBLZQGWVFQZ-UHFFFAOYSA-N

SMILES: C(N1C(C(O)=O)=CN=C1)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 1H-Imidazole-5-carboxylic acid, 1-[[3-(trifluoromethyl)phenyl]methyl]-
• 1-[[3-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-5-carboxylic acid

1-[3-(Trifluoromethyl)benzyl]-1H-imidazole-5-carboxylic acid

CAS: 1439899-43-0

Formula: C₁₂H₉F₃N₂O₂

Molecular weight: 270.211

Ref: 10-F096743