CAS 1439899-47-4
:2-[(Tetrahydro-2H-pyran-4-yl)methoxy]-5-pyrimidinecarboxylic acid
Description:
2-[(Tetrahydro-2H-pyran-4-yl)methoxy]-5-pyrimidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a tetrahydro-2H-pyran moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the methoxy group enhances its solubility and reactivity, while the carboxylic acid group can participate in hydrogen bonding and other interactions, influencing its biological activity. The compound may also exhibit moderate polarity due to the combination of hydrophobic and hydrophilic groups. Its molecular structure suggests potential for interactions with biological targets, which could be explored in drug development. As with many organic compounds, stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research and development.
Formula:C11H14N2O4
InChI:InChI=1S/C11H14N2O4/c14-10(15)9-5-12-11(13-6-9)17-7-8-1-3-16-4-2-8/h5-6,8H,1-4,7H2,(H,14,15)
InChI key:InChIKey=ITUNWEHQSAIIDG-UHFFFAOYSA-N
SMILES:O(CC1CCOCC1)C=2N=CC(C(O)=O)=CN2
Synonyms:- 2-[(Tetrahydro-2H-pyran-4-yl)methoxy]-5-pyrimidinecarboxylic acid
- 5-Pyrimidinecarboxylic acid, 2-[(tetrahydro-2H-pyran-4-yl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
