CAS 1439899-50-9
:4-[(Tetrahydro-2H-pyran-4-yl)methoxy]-3-pyridinecarboxylic acid
Description:
4-[(Tetrahydro-2H-pyran-4-yl)methoxy]-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a tetrahydro-2H-pyran moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. The tetrahydro-2H-pyran ring adds to the compound's complexity and can affect its conformational flexibility. This substance may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific interactions with biological targets would depend on its three-dimensional conformation and the functional groups present. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of heterocyclic organic molecules that are of interest in various fields, including drug development and synthetic chemistry.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c14-12(15)10-7-13-4-1-11(10)17-8-9-2-5-16-6-3-9/h1,4,7,9H,2-3,5-6,8H2,(H,14,15)
InChI key:InChIKey=CULCXSPVRCSKKM-UHFFFAOYSA-N
SMILES:O(CC1CCOCC1)C=2C(C(O)=O)=CN=CC2
Synonyms:- 3-Pyridinecarboxylic acid, 4-[(tetrahydro-2H-pyran-4-yl)methoxy]-
- 4-[(Tetrahydro-2H-pyran-4-yl)methoxy]-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
