CAS 14399-63-4
:(1-Hydroxy-cyclohexyl)-acetic acid
Description:
(1-Hydroxy-cyclohexyl)-acetic acid, with the CAS number 14399-63-4, is an organic compound characterized by its cyclohexyl structure and a hydroxyl group attached to the cyclohexane ring, along with an acetic acid functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in water and organic solvents, which makes it versatile for various applications. The presence of both hydroxyl and carboxylic acid functional groups contributes to its potential as a building block in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, it may exhibit properties such as mild acidity and the ability to participate in hydrogen bonding, influencing its reactivity and interactions with other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H14O3
InChI:InChI=1/C8H14O3/c9-7(10)6-8(11)4-2-1-3-5-8/h11H,1-6H2,(H,9,10)
SMILES:C1CCC(CC1)(CC(=O)O)O
Synonyms:- 1-Hydroxy-cyclohexylaceticacid
- Cyclohexaneacetic Acid, 1-Hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cyclohexaneacetic acid, 1-hydroxy-
CAS:Formula:C8H14O3Purity:%Color and Shape:SolidMolecular weight:158.19502-(1-Hydroxycyclohexyl)acetic acid
CAS:2-(1-Hydroxycyclohexyl)acetic acidPurity:95%Molecular weight:158.2g/mol(1-Hydroxy-cyclohexyl)-acetic acid
CAS:Formula:C8H14O3Purity:95+%Color and Shape:SolidMolecular weight:158.197(1-Hydroxycyclohexyl)acetic Acid
CAS:Controlled ProductFormula:C8H14O3Color and Shape:NeatMolecular weight:158.195(1-Hydroxy-cyclohexyl)-acetic acid
CAS:1-Hydroxy-cyclohexyl)-acetic acid (1HCAA) is a polystyrene-based monomer that is used in the production of polymers such as vinyl ethers. 1HCAA has been shown to undergo mechanistic reactions with solvents and alkali metal chlorides, which are both required for its synthesis. The 1HCAA molecule can react with water molecules and form monocarboxylic acids, carboxylic acids, or recemic products. 1HCAA also catalyzes cross-linking reactions when it reacts with an oxidizing agent such as iodine.Formula:C8H14O3Purity:Min. 95%Molecular weight:158.19 g/mol





