CAS 1439900-14-7: Cyclobutanamine, 1-[(3-methoxyphenyl)methyl]-, hydrochloride (1:1)

Description:Cyclobutanamine, 1-[(3-methoxyphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a methoxyphenyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical contexts. The presence of the methoxy group contributes to its potential biological activity, possibly influencing its interaction with biological targets. Cyclobutanamines are of interest in medicinal chemistry due to their potential as therapeutic agents, and the specific substitution pattern can affect their pharmacological properties, including potency and selectivity. The hydrochloride form is commonly used to improve stability and bioavailability. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility can vary based on the specific conditions and purity of the substance. Safety and handling precautions are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula:C₁₂H₁₇NO·ClH

InChI:InChI=1S/C12H17NO.ClH/c1-14-11-5-2-4-10(8-11)9-12(13)6-3-7-12;/h2,4-5,8H,3,6-7,9,13H2,1H3;1H

InChI key:InChIKey=NOFHIIYZFNJBIA-UHFFFAOYSA-N

SMILES:Cl.O(C1=CC=CC(=C1)CC2(N)CCC2)C