CAS 1439900-16-9

Cyclobutanamine, 1-[[4-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1)

Description:

Cyclobutanamine, 1-[[4-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its cyclobutane ring structure, which is a four-membered saturated cyclic hydrocarbon. The presence of a trifluoromethyl group attached to a phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the trifluoromethyl group, which can enhance binding affinity to certain biological targets. Additionally, the hydrochloride form can stabilize the compound and improve its handling and storage characteristics. Overall, this compound's unique structure and functional groups suggest potential utility in drug development, although specific biological activities and applications would require further investigation.

Formula: C₁₂H₁₄F₃N·ClH

InChI: InChI=1S/C12H14F3N.ClH/c13-12(14,15)10-4-2-9(3-5-10)8-11(16)6-1-7-11;/h2-5H,1,6-8,16H2;1H

InChI key: InChIKey=HSJHTTZKDRVXFA-UHFFFAOYSA-N

SMILES: C(C1(N)CCC1)C2=CC=C(C(F)(F)F)C=C2.Cl

Synonyms:

• Cyclobutanamine, 1-[[4-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1)

1-[4-(Trifluoromethyl)benzyl]cyclobutanamine hydrochloride

CAS: 1439900-16-9

Formula: C₁₂H₁₅ClF₃N

Molecular weight: 265.7

Ref: 10-F096944