CAS 1439900-21-6
:Cyclobutanamine, 1-(2-pyridinylmethyl)-, hydrochloride (1:2)
Description:
Cyclobutanamine, 1-(2-pyridinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a pyridine moiety. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interaction with biological systems. The pyridine ring contributes to its aromatic character and may affect its electronic properties, potentially making it a candidate for various chemical reactions or as a ligand in coordination chemistry. Additionally, the specific arrangement of functional groups can impart unique pharmacological properties, making it of interest in medicinal chemistry. As with any chemical substance, safety and handling precautions should be observed, particularly due to the potential biological activity associated with amine-containing compounds.
Formula:C10H14N2·2ClH
InChI:InChI=1S/C10H14N2.2ClH/c11-10(5-3-6-10)8-9-4-1-2-7-12-9;;/h1-2,4,7H,3,5-6,8,11H2;2*1H
InChI key:InChIKey=HWCBRJRLLHKHJR-UHFFFAOYSA-N
SMILES:C(C1(N)CCC1)C2=CC=CC=N2.Cl
Synonyms:- Cyclobutanamine, 1-(2-pyridinylmethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
