CAS 1439900-24-9

1H-Imidazole-5-carboxylic acid, 1-[(3-chlorophenyl)methyl]-

Description:

1H-Imidazole-5-carboxylic acid, 1-[(3-chlorophenyl)methyl]- is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential for forming salts or esters. The presence of the 3-chlorophenylmethyl group indicates that it has a chlorinated aromatic substituent, which can influence its reactivity and biological activity. The chlorophenyl moiety may enhance lipophilicity, potentially affecting the compound's solubility and interaction with biological targets. This compound may be of interest in medicinal chemistry and pharmaceutical research due to its structural features, which could impart specific pharmacological properties. Additionally, the imidazole ring is known for its role in various biological systems, including as a component of histidine in proteins. Overall, this compound's unique structure suggests potential applications in drug development and other chemical research areas.

Formula: C₁₁H₉ClN₂O₂

InChI: InChI=1S/C11H9ClN2O2/c12-9-3-1-2-8(4-9)6-14-7-13-5-10(14)11(15)16/h1-5,7H,6H2,(H,15,16)

InChI key: InChIKey=NYANUFPUSXRSHB-UHFFFAOYSA-N

SMILES: C(N1C(C(O)=O)=CN=C1)C2=CC(Cl)=CC=C2

Synonyms:

• 1-(3-Chlorobenzyl)-1H-imidazole-5-carboxylic acid
• 1-[(3-Chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid
• 1H-Imidazole-5-carboxylic acid, 1-[(3-chlorophenyl)methyl]-

1-(3-Chlorobenzyl)-1H-imidazole-5-carboxylic acid

CAS: 1439900-24-9

Formula: C₁₁H₉ClN₂O₂

Molecular weight: 236.66

Ref: 10-F096749