CAS 1439900-42-1

1-[(4-Bromophenyl)methyl]-1H-imidazole-4-carboxylic acid

Description:

1-[(4-Bromophenyl)methyl]-1H-imidazole-4-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a carboxylic acid functional group (-COOH) at the 4-position of the imidazole ring contributes to its acidic properties and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The 4-bromophenylmethyl substituent introduces a bromine atom, which can influence the compound's reactivity and biological activity due to the electron-withdrawing nature of the bromine. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions, including potential binding to biological targets, which could be explored in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the surrounding environment, making it important to consider these factors in practical applications.

Formula: C₁₁H₉BrN₂O₂

InChI: InChI=1S/C11H9BrN2O2/c12-9-3-1-8(2-4-9)5-14-6-10(11(15)16)13-7-14/h1-4,6-7H,5H2,(H,15,16)

InChI key: InChIKey=AXNHMCUTAMWHPV-UHFFFAOYSA-N

SMILES: C(N1C=C(C(O)=O)N=C1)C2=CC=C(Br)C=C2

Synonyms:

• 1-[(4-Bromophenyl)methyl]-1H-imidazole-4-carboxylic acid
• 1H-Imidazole-4-carboxylic acid, 1-[(4-bromophenyl)methyl]-

1-(4-Bromobenzyl)-1H-imidazole-4-carboxylic acid

CAS: 1439900-42-1

Formula: C₁₁H₉BrN₂O₂

Molecular weight: 281.109

Ref: 10-F096935