CAS 1439900-46-5
:1,6-Dihydro-6-oxo-1-(2,2,2-trifluoroethyl)-2-pyridinecarboxylic acid
Description:
1,6-Dihydro-6-oxo-1-(2,2,2-trifluoroethyl)-2-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a trifluoroethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The compound's diketone structure, indicated by the "6-oxo" designation, suggests potential reactivity in various chemical transformations. Additionally, the presence of fluorine atoms typically imparts unique properties, such as increased metabolic stability and altered pharmacokinetics. The compound's specific applications may vary, but it is likely to be explored in the context of drug development or as an intermediate in organic synthesis. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H6F3NO3
InChI:InChI=1S/C8H6F3NO3/c9-8(10,11)4-12-5(7(14)15)2-1-3-6(12)13/h1-3H,4H2,(H,14,15)
InChI key:InChIKey=YPTMUSIOZIZXCC-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)N1C(C(O)=O)=CC=CC1=O
Synonyms:- 1,6-Dihydro-6-oxo-1-(2,2,2-trifluoroethyl)-2-pyridinecarboxylic acid
- 2-Pyridinecarboxylic acid, 1,6-dihydro-6-oxo-1-(2,2,2-trifluoroethyl)-
- 6-Oxo-1-(2,2,2-trifluoroethyl)-1,6-dihydropyridine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Oxo-1-(2,2,2-trifluoroethyl)-1,6-dihydropyridine-2-carboxylic acid
CAS:Formula:C8H6F3NO3Molecular weight:221.135
