CAS 1439900-62-5: Tetrahydro-4-(5-methoxy-2-pyridinyl)-2H-pyran-4-methanamine

Description:Tetrahydro-4-(5-methoxy-2-pyridinyl)-2H-pyran-4-methanamine, identified by its CAS number 1439900-62-5, is a chemical compound characterized by its complex molecular structure, which includes a tetrahydropyran ring and a pyridine moiety. This compound features a methoxy group, which contributes to its potential solubility and reactivity. The presence of the amine functional group suggests that it may exhibit basic properties and could participate in various chemical reactions, including nucleophilic substitutions. Its structural features indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Additionally, the compound's stereochemistry may influence its interaction with biological targets, making it a subject of interest for further research. Overall, the characteristics of this compound highlight its potential utility in various chemical and biological contexts, although specific properties such as melting point, boiling point, and solubility would require empirical determination.

Formula:C₁₂H₁₈N₂O₂

InChI:InChI=1S/C12H18N2O2/c1-15-10-2-3-11(14-8-10)12(9-13)4-6-16-7-5-12/h2-3,8H,4-7,9,13H2,1H3

InChI key:InChIKey=CTYFSOQJQVOKJH-UHFFFAOYSA-N

SMILES:N=1C=C(OC)C=CC1C2(CN)CCOCC2