CymitQuimica logo

CAS 1439902-19-8

:

6-Bromo-3-(2-pyridinyl)-1,2,4-triazolo[4,3-a]pyridine

Description:
6-Bromo-3-(2-pyridinyl)-1,2,4-triazolo[4,3-a]pyridine is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety. The presence of a bromine atom at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. This compound exhibits properties typical of triazole derivatives, such as the ability to form hydrogen bonds, which can enhance its interactions with biological targets. The pyridine substituent at the 3-position may influence its lipophilicity and solubility, affecting its pharmacokinetic profile. Additionally, the compound may exhibit biological activity, making it of interest in drug discovery and development. Its unique structural features allow for potential applications in various fields, including agrochemicals and pharmaceuticals. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its properties and potential uses in research and industry.
Formula:C11H7BrN4
InChI:InChI=1S/C11H7BrN4/c12-8-4-5-10-14-15-11(16(10)7-8)9-3-1-2-6-13-9/h1-7H
InChI key:InChIKey=GOGYPUORLJBFGR-UHFFFAOYSA-N
SMILES:BrC1=CN2C(=NN=C2C=C1)C3=CC=CC=N3
Synonyms:
  • 6-Bromo-3-(2-pyridinyl)-1,2,4-triazolo[4,3-a]pyridine
  • 1,2,4-Triazolo[4,3-a]pyridine, 6-bromo-3-(2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.