CymitQuimica logo

CAS 1439902-40-5

:

1-(4-Chlorophenyl)-1H-imidazole-5-carboxylic acid

Description:
1-(4-Chlorophenyl)-1H-imidazole-5-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 4-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the para position, which can influence the compound's electronic properties and biological activity. The carboxylic acid functional group (-COOH) at the 5-position of the imidazole ring contributes to its acidity and potential reactivity, making it a candidate for various chemical reactions, including esterification and amidation. This compound may exhibit interesting pharmacological properties, potentially serving as a scaffold for drug development. Its solubility, stability, and reactivity can be influenced by the presence of the chlorine substituent and the carboxylic acid group, which may also affect its interactions in biological systems. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and material science.
Formula:C10H7ClN2O2
InChI:InChI=1S/C10H7ClN2O2/c11-7-1-3-8(4-2-7)13-6-12-5-9(13)10(14)15/h1-6H,(H,14,15)
InChI key:InChIKey=GPKHSVMMFDKURK-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N(C=NC1)C2=CC=C(Cl)C=C2
Synonyms:
  • 1-(4-Chlorophenyl)-1H-imidazole-5-carboxylic acid
  • 1H-Imidazole-5-carboxylic acid, 1-(4-chlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.