CymitQuimica logo

CAS 1439902-43-8

:

1-[(4-Fluorophenyl)methyl]-1H-imidazole-5-carboxylic acid

Description:
1-[(4-Fluorophenyl)methyl]-1H-imidazole-5-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 4-fluorophenyl group attached to the methyl position of the imidazole enhances its lipophilicity and may influence its biological activity. The carboxylic acid functional group at the 5-position contributes to its acidity and potential for forming hydrogen bonds, which can be significant in interactions with biological targets. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the fluorine atom can enhance metabolic stability and influence the compound's pharmacokinetic properties. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further investigation in various chemical and biological contexts.
Formula:C11H9FN2O2
InChI:InChI=1S/C11H9FN2O2/c12-9-3-1-8(2-4-9)6-14-7-13-5-10(14)11(15)16/h1-5,7H,6H2,(H,15,16)
InChI key:InChIKey=LHBHHLULXQCMAL-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N(CC2=CC=C(F)C=C2)C=NC1
Synonyms:
  • 1-[(4-Fluorophenyl)methyl]-1H-imidazole-5-carboxylic acid
  • 1H-Imidazole-5-carboxylic acid, 1-[(4-fluorophenyl)methyl]-
  • 3-[(4-fluorophenyl)methyl]imidazole-4-carboxylic acid
  • 3-(4-Fluoro-benzyl)-3H-imidazole-4-carboxylic acid
  • 1-(4-Fluorobenzyl)-1H-imidazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.