CymitQuimica logo

CAS 1439902-53-0

:

Benzeneethanamine, 2-methoxy-α,α-dimethyl-, hydrochloride (1:1)

Description:
Benzeneethanamine, 2-methoxy-α,α-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and aromatic structure. It features a benzene ring substituted with an ethylamine group and a methoxy group, contributing to its unique properties. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, which enhances its solubility in water and may influence its biological activity. This compound is likely to exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. The specific interactions and reactivity of this compound can be influenced by the steric and electronic effects of the substituents on the benzene ring. As with many amines, it may also exhibit varying degrees of toxicity and should be handled with appropriate safety precautions in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H17NO·ClH
InChI:InChI=1S/C11H17NO.ClH/c1-11(2,12)8-9-6-4-5-7-10(9)13-3;/h4-7H,8,12H2,1-3H3;1H
InChI key:InChIKey=XAJDJNOUJKEJSA-UHFFFAOYSA-N
SMILES:C(C(C)(C)N)C1=C(OC)C=CC=C1.Cl
Synonyms:
  • Benzeneethanamine, 2-methoxy-α,α-dimethyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.