CAS 1439902-65-4
:3-Amino-1-(cyclopropylmethyl)-2(1H)-pyridinone
Description:
3-Amino-1-(cyclopropylmethyl)-2(1H)-pyridinone is a chemical compound characterized by its pyridinone structure, which features a pyridine ring with a ketone and an amino group. The presence of the cyclopropylmethyl group introduces unique steric and electronic properties, potentially influencing its reactivity and biological activity. This compound may exhibit solubility in polar solvents due to the presence of the amino group, while the cyclopropyl moiety can contribute to its hydrophobic characteristics. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often show biological activity. Additionally, the specific arrangement of functional groups can affect the compound's interaction with biological targets, making it a candidate for further investigation in drug discovery. As with many organic compounds, the stability, reactivity, and potential toxicity would need to be assessed through experimental studies to fully understand its properties and applications.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c10-8-2-1-5-11(9(8)12)6-7-3-4-7/h1-2,5,7H,3-4,6,10H2
InChI key:InChIKey=MKUGDFLTSZSOBI-UHFFFAOYSA-N
SMILES:C(N1C(=O)C(N)=CC=C1)C2CC2
Synonyms:- 3-Amino-1-(cyclopropylmethyl)pyridin-2-one
- 3-Amino-1-(cyclopropylmethyl)-2(1H)-pyridinone
- 3-Amino-1-cyclopropylmethyl-1H-pyridin-2-one
- 3-Amino-1-(cyclopropylmethyl)-1,2-dihydropyridin-2-one
- 2(1H)-Pyridinone, 3-amino-1-(cyclopropylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
