CymitQuimica logo

CAS 1439902-90-5

:

6-[(Cyclopropylmethyl)amino]-4-pyrimidinecarboxylic acid

Description:
6-[(Cyclopropylmethyl)amino]-4-pyrimidinecarboxylic acid, identified by its CAS number 1439902-90-5, is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a cyclopropylmethyl group attached to the amino functionality at the 6-position contributes to its unique structural properties. This compound typically exhibits properties associated with both acidic and basic functionalities due to the carboxylic acid group and the amino group, respectively. It may participate in hydrogen bonding, influencing its solubility and reactivity in various solvents. The compound's potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals, given the importance of pyrimidine derivatives in drug design. Its specific interactions and biological activity would depend on further studies, including its pharmacokinetics and mechanism of action. Overall, this compound represents a valuable structure for research in organic and medicinal chemistry.
Formula:C9H11N3O2
InChI:InChI=1S/C9H11N3O2/c13-9(14)7-3-8(12-5-11-7)10-4-6-1-2-6/h3,5-6H,1-2,4H2,(H,13,14)(H,10,11,12)
InChI key:InChIKey=USYSCAZORDXFAE-UHFFFAOYSA-N
SMILES:N(CC1CC1)C=2C=C(C(O)=O)N=CN2
Synonyms:
  • 6-[(Cyclopropylmethyl)amino]-4-pyrimidinecarboxylic acid
  • 4-Pyrimidinecarboxylic acid, 6-[(cyclopropylmethyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.