CAS 1439902-98-3: 1-(3-Fluoro-2-pyridinyl)cyclopropanemethanamine

Description: 1-(3-Fluoro-2-pyridinyl)cyclopropanemethanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of a fluorine atom at the 3-position of the pyridine ring contributes to its electronic properties and potential reactivity. This compound is classified as an amine due to the presence of the amine functional group (-NH2), which can participate in hydrogen bonding and influence its solubility and interaction with biological systems. The cyclopropane structure adds strain and rigidity to the molecule, potentially affecting its conformational dynamics and reactivity. Such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's interactions with solvents and other substances. Overall, 1-(3-Fluoro-2-pyridinyl)cyclopropanemethanamine represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₉H₁₁FN₂

InChI: InChI=1S/C9H11FN2/c10-7-2-1-5-12-8(7)9(6-11)3-4-9/h1-2,5H,3-4,6,11H2

InChI key: InChIKey=UNSXQOKMIVAGDF-UHFFFAOYSA-N

SMILES: FC1=CC=CN=C1C2(CN)CC2

Synonyms:

• Cyclopropanemethanamine, 1-(3-fluoro-2-pyridinyl)-
• 1-(3-Fluoro-2-pyridinyl)cyclopropanemethanamine

[1-(3-Fluoropyridin-2-yl)cyclopropyl]methanamine

CAS: 1439902-98-3

Versatile small molecule scaffold

• Formula: C₉H₁₁FN₂
• Purity: Min. 95%
• Molecular weight: 166.2 g/mol

[1-(3-Fluoropyridin-2-yl)cyclopropyl]methanamine

CAS: 1439902-98-3

• Molecular weight: 166.19900512695312