CAS 1439903-08-8

Benzeneethanamine, α,α-dimethyl-2-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzeneethanamine, α,α-dimethyl-2-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and the presence of a trifluoromethyl group, which significantly influences its chemical properties and reactivity. This compound features a benzene ring attached to an ethylamine structure, with two methyl groups on the alpha carbon, enhancing its steric bulk. The trifluoromethyl group contributes to its lipophilicity and can affect its biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, facilitating its handling and application in various chemical processes. The presence of the hydrochloride indicates that the compound can exist in a protonated form, which may influence its interaction with biological targets. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₁H₁₄F₃N·ClH

InChI: InChI=1S/C11H14F3N.ClH/c1-10(2,15)7-8-5-3-4-6-9(8)11(12,13)14;/h3-6H,7,15H2,1-2H3;1H

InChI key: InChIKey=YORFBBIDPQPWGA-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(CC(C)(C)N)C=CC=C1.Cl

Synonyms:

• Benzeneethanamine, α,α-dimethyl-2-(trifluoromethyl)-, hydrochloride (1:1)

2-Methyl-1-[2-(trifluoromethyl)phenyl]propan-2-amine hydrochloride

CAS: 1439903-08-8

Formula: C₁₁H₁₅ClF₃N

Color and Shape: Solid

Molecular weight: 253.69

Ref: 10-F096989